C21H27NO4 — CID 71313766
(2R,3R,4S,5R)-5-methoxy-2-methyl-4,6-bis(phenylmethoxy)oxan-3-amine (PubChem CID 71313766) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is (2R,3R,4S,5R)-5-methoxy-2-methyl-4,6-bis(phenylmethoxy)oxan-3-amine.
| Compound Name | (2R,3R,4S,5R)-5-methoxy-2-methyl-4,6-bis(phenylmethoxy)oxan-3-amine |
|---|---|
| PubChem CID | 71313766 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | (2R,3R,4S,5R)-5-methoxy-2-methyl-4,6-bis(phenylmethoxy)oxan-3-amine |
| SMILES | CO[C@H]1C(OCc2ccccc2)O[C@H](C)[C@@H](N)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C21H27NO4/c1-15-18(22)19(24-13-16-9-5-3-6-10-16)20(23-2)21(26-15)25-14-17-11-7-4-8-12-17/h3-12,15,18-21H,13-14,22H2,1-2H3/t15-,18-,19+,20-,21?/m1/s1 |
| InChIKey | QFMDGEXHHDCMBN-IJFYFLOXSA-N |
| XLogP | 2.88 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |