C14H19FO4 — CID 14052144
(2R,3R,4R,5S,6S)-3-fluoro-2-methoxy-6-methyl-5-phenylmethoxyoxan-4-ol (PubChem CID 14052144) has the molecular formula C14H19FO4 and a molecular weight of 270.30 g/mol. Its IUPAC name is (2R,3R,4R,5S,6S)-3-fluoro-2-methoxy-6-methyl-5-phenylmethoxyoxan-4-ol.
| Compound Name | (2R,3R,4R,5S,6S)-3-fluoro-2-methoxy-6-methyl-5-phenylmethoxyoxan-4-ol |
|---|---|
| PubChem CID | 14052144 |
| Molecular Formula | C14H19FO4 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | (2R,3R,4R,5S,6S)-3-fluoro-2-methoxy-6-methyl-5-phenylmethoxyoxan-4-ol |
| SMILES | CO[C@@H]1O[C@@H](C)[C@@H](OCc2ccccc2)[C@@H](O)[C@H]1F |
| InChI | InChI=1S/C14H19FO4/c1-9-13(12(16)11(15)14(17-2)19-9)18-8-10-6-4-3-5-7-10/h3-7,9,11-14,16H,8H2,1-2H3/t9-,11+,12-,13+,14+/m0/s1 |
| InChIKey | ASKHVMHIQMRPQZ-JWZAGAIZSA-N |
| XLogP | 1.66 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |