C27H30O6 — CID 25178075
(2S,3R,4R,5R,6S)-2-(4-methoxyphenoxy)-6-methyl-3,5-bis(phenylmethoxy)oxan-4-ol (PubChem CID 25178075) has the molecular formula C27H30O6 and a molecular weight of 450.53 g/mol. Its IUPAC name is (2S,3R,4R,5R,6S)-2-(4-methoxyphenoxy)-6-methyl-3,5-bis(phenylmethoxy)oxan-4-ol.
| Compound Name | (2S,3R,4R,5R,6S)-2-(4-methoxyphenoxy)-6-methyl-3,5-bis(phenylmethoxy)oxan-4-ol |
|---|---|
| PubChem CID | 25178075 |
| Molecular Formula | C27H30O6 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | (2S,3R,4R,5R,6S)-2-(4-methoxyphenoxy)-6-methyl-3,5-bis(phenylmethoxy)oxan-4-ol |
| SMILES | COc1ccc(O[C@@H]2O[C@@H](C)[C@H](OCc3ccccc3)[C@@H](O)[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H30O6/c1-19-25(30-17-20-9-5-3-6-10-20)24(28)26(31-18-21-11-7-4-8-12-21)27(32-19)33-23-15-13-22(29-2)14-16-23/h3-16,19,24-28H,17-18H2,1-2H3/t19-,24+,25-,26+,27-/m0/s1 |
| InChIKey | CQXHONRZWLQLCO-YNOCBOJOSA-N |
| XLogP | 4.35 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |