C42H44O7 — CID 11039611
(1S,2S,3R,4R,5S,6S)-2-[(4-methoxyphenyl)methoxy]-3,4,5,6-tetrakis(phenylmethoxy)cyclohexan-1-ol (PubChem CID 11039611) has the molecular formula C42H44O7 and a molecular weight of 660.81 g/mol. Its IUPAC name is (1S,2S,3R,4R,5S,6S)-2-[(4-methoxyphenyl)methoxy]-3,4,5,6-tetrakis(phenylmethoxy)cyclohexan-1-ol.
| Compound Name | (1S,2S,3R,4R,5S,6S)-2-[(4-methoxyphenyl)methoxy]-3,4,5,6-tetrakis(phenylmethoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 11039611 |
| Molecular Formula | C42H44O7 |
| Molecular Weight | 660.81 g/mol |
| Exact Mass | 660.31 |
| IUPAC Name | (1S,2S,3R,4R,5S,6S)-2-[(4-methoxyphenyl)methoxy]-3,4,5,6-tetrakis(phenylmethoxy)cyclohexan-1-ol |
| SMILES | COc1ccc(COC2[C@@H](O)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C42H44O7/c1-44-36-24-22-35(23-25-36)30-46-39-37(43)38(45-26-31-14-6-2-7-15-31)40(47-27-32-16-8-3-9-17-32)42(49-29-34-20-12-5-13-21-34)41(39)48-28-33-18-10-4-11-19-33/h2-25,37-43H,26-30H2,1H3/t37-,38-,39?,40-,41+,42+/m0/s1 |
| InChIKey | VRHOTTZVJLLNQT-LDDAFCGXSA-N |
| XLogP | 7.30 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.81 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |