C38H42O7 — CID 46845459
(1S,2S,3S,4S,5S,6R)-2-[(4-methoxyphenyl)methoxy]-4,5,6-tris(phenylmethoxy)-3-prop-2-enoxycyclohexan-1-ol (PubChem CID 46845459) has the molecular formula C38H42O7 and a molecular weight of 610.75 g/mol. Its IUPAC name is (1S,2S,3S,4S,5S,6R)-2-[(4-methoxyphenyl)methoxy]-4,5,6-tris(phenylmethoxy)-3-prop-2-enoxycyclohexan-1-ol.
| Compound Name | (1S,2S,3S,4S,5S,6R)-2-[(4-methoxyphenyl)methoxy]-4,5,6-tris(phenylmethoxy)-3-prop-2-enoxycyclohexan-1-ol |
|---|---|
| PubChem CID | 46845459 |
| Molecular Formula | C38H42O7 |
| Molecular Weight | 610.75 g/mol |
| Exact Mass | 610.29 |
| IUPAC Name | (1S,2S,3S,4S,5S,6R)-2-[(4-methoxyphenyl)methoxy]-4,5,6-tris(phenylmethoxy)-3-prop-2-enoxycyclohexan-1-ol |
| SMILES | C=CCO[C@@H]1[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](O)[C@@H]1OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C38H42O7/c1-3-23-41-36-34(43-27-31-19-21-32(40-2)22-20-31)33(39)35(42-24-28-13-7-4-8-14-28)37(44-25-29-15-9-5-10-16-29)38(36)45-26-30-17-11-6-12-18-30/h3-22,33-39H,1,23-27H2,2H3/t33-,34-,35+,36-,37-,38-/m0/s1 |
| InChIKey | KBGZQQIJFIZYMF-ZUQDGUHMSA-N |
| XLogP | 6.28 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.75 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|