C30H34O6 — CID 11755326
(1R,2S,3S,4R,5R,6S)-3,4,5-tris(phenylmethoxy)-6-prop-2-enoxycyclohexane-1,2-diol (PubChem CID 11755326) has the molecular formula C30H34O6 and a molecular weight of 490.60 g/mol. Its IUPAC name is (1R,2S,3S,4R,5R,6S)-3,4,5-tris(phenylmethoxy)-6-prop-2-enoxycyclohexane-1,2-diol.
| Compound Name | (1R,2S,3S,4R,5R,6S)-3,4,5-tris(phenylmethoxy)-6-prop-2-enoxycyclohexane-1,2-diol |
|---|---|
| PubChem CID | 11755326 |
| Molecular Formula | C30H34O6 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | (1R,2S,3S,4R,5R,6S)-3,4,5-tris(phenylmethoxy)-6-prop-2-enoxycyclohexane-1,2-diol |
| SMILES | C=CCO[C@H]1[C@H](O)[C@H](O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C30H34O6/c1-2-18-33-27-25(31)26(32)28(34-19-22-12-6-3-7-13-22)30(36-21-24-16-10-5-11-17-24)29(27)35-20-23-14-8-4-9-15-23/h2-17,25-32H,1,18-21H2/t25-,26+,27+,28+,29-,30-/m1/s1 |
| InChIKey | FCFCHTVNSSOGKC-ZSBACWSISA-N |
| XLogP | 4.05 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|