C31H36O6 — CID 101166446
(1R,2R,3S,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-(prop-2-enoxymethyl)cyclohexane-1,2-diol (PubChem CID 101166446) has the molecular formula C31H36O6 and a molecular weight of 504.62 g/mol. Its IUPAC name is (1R,2R,3S,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-(prop-2-enoxymethyl)cyclohexane-1,2-diol.
| Compound Name | (1R,2R,3S,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-(prop-2-enoxymethyl)cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 101166446 |
| Molecular Formula | C31H36O6 |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | (1R,2R,3S,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-(prop-2-enoxymethyl)cyclohexane-1,2-diol |
| SMILES | C=CCOCC1[C@@H](O)[C@@H](O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C31H36O6/c1-2-18-34-22-26-27(32)28(33)30(36-20-24-14-8-4-9-15-24)31(37-21-25-16-10-5-11-17-25)29(26)35-19-23-12-6-3-7-13-23/h2-17,26-33H,1,18-22H2/t26?,27-,28-,29-,30+,31+/m1/s1 |
| InChIKey | AFBJSRSCYSQMNJ-GKTVFZJQSA-N |
| XLogP | 4.30 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|