C26H32O6 — CID 14655276
(3S,4S,5R,6R)-3,5-bis(phenylmethoxy)-4-prop-2-enoxy-6-(prop-2-enoxymethyl)oxan-2-ol (PubChem CID 14655276) has the molecular formula C26H32O6 and a molecular weight of 440.54 g/mol. Its IUPAC name is (3S,4S,5R,6R)-3,5-bis(phenylmethoxy)-4-prop-2-enoxy-6-(prop-2-enoxymethyl)oxan-2-ol.
| Compound Name | (3S,4S,5R,6R)-3,5-bis(phenylmethoxy)-4-prop-2-enoxy-6-(prop-2-enoxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 14655276 |
| Molecular Formula | C26H32O6 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | (3S,4S,5R,6R)-3,5-bis(phenylmethoxy)-4-prop-2-enoxy-6-(prop-2-enoxymethyl)oxan-2-ol |
| SMILES | C=CCOC[C@H]1OC(O)[C@@H](OCc2ccccc2)[C@@H](OCC=C)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C26H32O6/c1-3-15-28-19-22-23(30-17-20-11-7-5-8-12-20)24(29-16-4-2)25(26(27)32-22)31-18-21-13-9-6-10-14-21/h3-14,22-27H,1-2,15-19H2/t22-,23-,24+,25+,26?/m1/s1 |
| InChIKey | DLCWNPOQLCIWRZ-APQRZRNDSA-N |
| XLogP | 3.65 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|