C30H34O6 — CID 134865887
(5R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enoxyoxan-3-ol (PubChem CID 134865887) has the molecular formula C30H34O6 and a molecular weight of 490.60 g/mol. Its IUPAC name is (5R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enoxyoxan-3-ol.
| Compound Name | (5R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enoxyoxan-3-ol |
|---|---|
| PubChem CID | 134865887 |
| Molecular Formula | C30H34O6 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | (5R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enoxyoxan-3-ol |
| SMILES | C=CCOC1OC(COCc2ccccc2)[C@@H](OCc2ccccc2)C(OCc2ccccc2)C1O |
| InChI | InChI=1S/C30H34O6/c1-2-18-33-30-27(31)29(35-21-25-16-10-5-11-17-25)28(34-20-24-14-8-4-9-15-24)26(36-30)22-32-19-23-12-6-3-7-13-23/h2-17,26-31H,1,18-22H2/t26?,27?,28-,29?,30?/m1/s1 |
| InChIKey | JPYPRPLACOYAAA-PNFCBGFJSA-N |
| XLogP | 4.66 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|