C24H30O6 — CID 100923922
(2S,3R,4S,5S,6R)-2-methoxy-5-phenylmethoxy-6-(phenylmethoxymethyl)-3-prop-2-enoxyoxan-4-ol (PubChem CID 100923922) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-methoxy-5-phenylmethoxy-6-(phenylmethoxymethyl)-3-prop-2-enoxyoxan-4-ol.
| Compound Name | (2S,3R,4S,5S,6R)-2-methoxy-5-phenylmethoxy-6-(phenylmethoxymethyl)-3-prop-2-enoxyoxan-4-ol |
|---|---|
| PubChem CID | 100923922 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-methoxy-5-phenylmethoxy-6-(phenylmethoxymethyl)-3-prop-2-enoxyoxan-4-ol |
| SMILES | C=CCO[C@H]1[C@@H](OC)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C24H30O6/c1-3-14-28-23-21(25)22(29-16-19-12-8-5-9-13-19)20(30-24(23)26-2)17-27-15-18-10-6-4-7-11-18/h3-13,20-25H,1,14-17H2,2H3/t20-,21+,22-,23-,24+/m1/s1 |
| InChIKey | PFKVKQGEFHUCDY-HUUMMWPTSA-N |
| XLogP | 3.09 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|