C33H38O6 — CID 67465607
(2R,3R,4S,5R,6S)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-5,6-bis(prop-2-enoxy)oxane (PubChem CID 67465607) has the molecular formula C33H38O6 and a molecular weight of 530.66 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-5,6-bis(prop-2-enoxy)oxane.
| Compound Name | (2R,3R,4S,5R,6S)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-5,6-bis(prop-2-enoxy)oxane |
|---|---|
| PubChem CID | 67465607 |
| Molecular Formula | C33H38O6 |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | (2R,3R,4S,5R,6S)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-5,6-bis(prop-2-enoxy)oxane |
| SMILES | C=CCO[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCC=C |
| InChI | InChI=1S/C33H38O6/c1-3-20-35-32-31(38-24-28-18-12-7-13-19-28)30(37-23-27-16-10-6-11-17-27)29(39-33(32)36-21-4-2)25-34-22-26-14-8-5-9-15-26/h3-19,29-33H,1-2,20-25H2/t29-,30-,31+,32-,33+/m1/s1 |
| InChIKey | RBKDMDNZXGDGJZ-AALIFHQRSA-N |
| XLogP | 5.87 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|