C24H30O5 — CID 91341625
(3S,4S,6R)-5-methyl-4-phenylmethoxy-2-(phenylmethoxymethyl)-6-prop-2-enoxyoxan-3-ol (PubChem CID 91341625) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is (3S,4S,6R)-5-methyl-4-phenylmethoxy-2-(phenylmethoxymethyl)-6-prop-2-enoxyoxan-3-ol.
| Compound Name | (3S,4S,6R)-5-methyl-4-phenylmethoxy-2-(phenylmethoxymethyl)-6-prop-2-enoxyoxan-3-ol |
|---|---|
| PubChem CID | 91341625 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | (3S,4S,6R)-5-methyl-4-phenylmethoxy-2-(phenylmethoxymethyl)-6-prop-2-enoxyoxan-3-ol |
| SMILES | C=CCO[C@@H]1OC(COCc2ccccc2)[C@@H](O)[C@@H](OCc2ccccc2)C1C |
| InChI | InChI=1S/C24H30O5/c1-3-14-27-24-18(2)23(28-16-20-12-8-5-9-13-20)22(25)21(29-24)17-26-15-19-10-6-4-7-11-19/h3-13,18,21-25H,1,14-17H2,2H3/t18?,21?,22-,23+,24-/m1/s1 |
| InChIKey | VQEZFEUJMXMKDE-RFQLJHMTSA-N |
| XLogP | 3.71 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|