C19H26O6 — CID 102163067
(2S,3S,4S,5R,6R)-2-phenylmethoxy-4-prop-2-enoxy-6-(prop-2-enoxymethyl)oxane-3,5-diol (PubChem CID 102163067) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-2-phenylmethoxy-4-prop-2-enoxy-6-(prop-2-enoxymethyl)oxane-3,5-diol.
| Compound Name | (2S,3S,4S,5R,6R)-2-phenylmethoxy-4-prop-2-enoxy-6-(prop-2-enoxymethyl)oxane-3,5-diol |
|---|---|
| PubChem CID | 102163067 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (2S,3S,4S,5R,6R)-2-phenylmethoxy-4-prop-2-enoxy-6-(prop-2-enoxymethyl)oxane-3,5-diol |
| SMILES | C=CCOC[C@H]1O[C@H](OCc2ccccc2)[C@@H](O)[C@@H](OCC=C)[C@@H]1O |
| InChI | InChI=1S/C19H26O6/c1-3-10-22-13-15-16(20)18(23-11-4-2)17(21)19(25-15)24-12-14-8-6-5-7-9-14/h3-9,15-21H,1-2,10-13H2/t15-,16-,17+,18+,19+/m1/s1 |
| InChIKey | MBFGFPHUMNXLNX-GFEQUFNTSA-N |
| XLogP | 1.42 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|