C23H28O7 — CID 10949753
(2S,3R,4S,5S,6R)-2-(4-methoxyphenoxy)-6-(phenylmethoxymethyl)-4-prop-2-enoxyoxane-3,5-diol (PubChem CID 10949753) has the molecular formula C23H28O7 and a molecular weight of 416.47 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-(4-methoxyphenoxy)-6-(phenylmethoxymethyl)-4-prop-2-enoxyoxane-3,5-diol.
| Compound Name | (2S,3R,4S,5S,6R)-2-(4-methoxyphenoxy)-6-(phenylmethoxymethyl)-4-prop-2-enoxyoxane-3,5-diol |
|---|---|
| PubChem CID | 10949753 |
| Molecular Formula | C23H28O7 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-(4-methoxyphenoxy)-6-(phenylmethoxymethyl)-4-prop-2-enoxyoxane-3,5-diol |
| SMILES | C=CCO[C@H]1[C@@H](O)[C@@H](COCc2ccccc2)O[C@@H](Oc2ccc(OC)cc2)[C@@H]1O |
| InChI | InChI=1S/C23H28O7/c1-3-13-28-22-20(24)19(15-27-14-16-7-5-4-6-8-16)30-23(21(22)25)29-18-11-9-17(26-2)10-12-18/h3-12,19-25H,1,13-15H2,2H3/t19-,20+,21-,22+,23-/m1/s1 |
| InChIKey | MGSFBNRLBFVMKU-ISBRNDMJSA-N |
| XLogP | 2.31 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|