C17H24O7 — CID 171126360
6-[(4-methoxyphenyl)methoxymethyl]-4-prop-2-enoxyoxane-2,3,5-triol (PubChem CID 171126360) has the molecular formula C17H24O7 and a molecular weight of 340.37 g/mol. Its IUPAC name is 6-[(4-methoxyphenyl)methoxymethyl]-4-prop-2-enoxyoxane-2,3,5-triol.
| Compound Name | 6-[(4-methoxyphenyl)methoxymethyl]-4-prop-2-enoxyoxane-2,3,5-triol |
|---|---|
| PubChem CID | 171126360 |
| Molecular Formula | C17H24O7 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 6-[(4-methoxyphenyl)methoxymethyl]-4-prop-2-enoxyoxane-2,3,5-triol |
| SMILES | C=CCOC1C(O)C(O)OC(COCc2ccc(OC)cc2)C1O |
| InChI | InChI=1S/C17H24O7/c1-3-8-23-16-14(18)13(24-17(20)15(16)19)10-22-9-11-4-6-12(21-2)7-5-11/h3-7,13-20H,1,8-10H2,2H3 |
| InChIKey | RTQFMVLARKYWPZ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|