C17H22O8 — CID 171124176
(3,5,6-trihydroxy-4-prop-2-enoxyoxan-2-yl)methyl 4-methoxybenzoate (PubChem CID 171124176) has the molecular formula C17H22O8 and a molecular weight of 354.36 g/mol. Its IUPAC name is (3,5,6-trihydroxy-4-prop-2-enoxyoxan-2-yl)methyl 4-methoxybenzoate.
| Compound Name | (3,5,6-trihydroxy-4-prop-2-enoxyoxan-2-yl)methyl 4-methoxybenzoate |
|---|---|
| PubChem CID | 171124176 |
| Molecular Formula | C17H22O8 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | (3,5,6-trihydroxy-4-prop-2-enoxyoxan-2-yl)methyl 4-methoxybenzoate |
| SMILES | C=CCOC1C(O)C(O)OC(COC(=O)c2ccc(OC)cc2)C1O |
| InChI | InChI=1S/C17H22O8/c1-3-8-23-15-13(18)12(25-17(21)14(15)19)9-24-16(20)10-4-6-11(22-2)7-5-10/h3-7,12-15,17-19,21H,1,8-9H2,2H3 |
| InChIKey | PUFSFQAETSLIMT-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|