C19H20O8 — CID 163900364
[(2R,3S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 4-phenoxybenzoate (PubChem CID 163900364) has the molecular formula C19H20O8 and a molecular weight of 376.36 g/mol. Its IUPAC name is [(2R,3S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 4-phenoxybenzoate.
| Compound Name | [(2R,3S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 4-phenoxybenzoate |
|---|---|
| PubChem CID | 163900364 |
| Molecular Formula | C19H20O8 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | [(2R,3S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 4-phenoxybenzoate |
| SMILES | O=C(OC[C@H]1OC(O)[C@H](O)C(O)[C@@H]1O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C19H20O8/c20-15-14(27-19(24)17(22)16(15)21)10-25-18(23)11-6-8-13(9-7-11)26-12-4-2-1-3-5-12/h1-9,14-17,19-22,24H,10H2/t14-,15-,16?,17-,19?/m1/s1 |
| InChIKey | QJHMTWZACCXZIJ-FOVNGAOHSA-N |
| XLogP | 0.44 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |