C16H22O7 — CID 130399974
[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 4-ethyl-3-methylbenzoate (PubChem CID 130399974) has the molecular formula C16H22O7 and a molecular weight of 326.35 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 4-ethyl-3-methylbenzoate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 4-ethyl-3-methylbenzoate |
|---|---|
| PubChem CID | 130399974 |
| Molecular Formula | C16H22O7 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 4-ethyl-3-methylbenzoate |
| SMILES | CCc1ccc(C(=O)OC[C@H]2OC(O)[C@H](O)[C@@H](O)[C@H]2O)cc1C |
| InChI | InChI=1S/C16H22O7/c1-3-9-4-5-10(6-8(9)2)15(20)22-7-11-12(17)13(18)14(19)16(21)23-11/h4-6,11-14,16-19,21H,3,7H2,1-2H3/t11-,12+,13+,14-,16?/m1/s1 |
| InChIKey | JRNMCMJARSHXLI-OFOQMZHDSA-N |
| XLogP | -0.49 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |