C21H24O9 — CID 161168989
[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 3-methoxy-4-phenylmethoxybenzoate (PubChem CID 161168989) has the molecular formula C21H24O9 and a molecular weight of 420.41 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 3-methoxy-4-phenylmethoxybenzoate.
| Compound Name | [(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 3-methoxy-4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 161168989 |
| Molecular Formula | C21H24O9 |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | [(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 3-methoxy-4-phenylmethoxybenzoate |
| SMILES | COc1cc(C(=O)OC[C@H]2OC(O)[C@H](O)[C@@H](O)[C@@H]2O)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C21H24O9/c1-27-15-9-13(7-8-14(15)28-10-12-5-3-2-4-6-12)20(25)29-11-16-17(22)18(23)19(24)21(26)30-16/h2-9,16-19,21-24,26H,10-11H2,1H3/t16-,17-,18+,19-,21?/m1/s1 |
| InChIKey | UQXUXEFTAGHDQU-AVPDHNOJSA-N |
| XLogP | 0.23 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |