C19H25NO4 — CID 145103744
N,N-dimethylmethanamine;methyl 3-methoxy-4-phenylmethoxybenzoate (PubChem CID 145103744) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is N,N-dimethylmethanamine;methyl 3-methoxy-4-phenylmethoxybenzoate.
| Compound Name | N,N-dimethylmethanamine;methyl 3-methoxy-4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 145103744 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | N,N-dimethylmethanamine;methyl 3-methoxy-4-phenylmethoxybenzoate |
| SMILES | CN(C)C.COC(=O)c1ccc(OCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C16H16O4.C3H9N/c1-18-15-10-13(16(17)19-2)8-9-14(15)20-11-12-6-4-3-5-7-12;1-4(2)3/h3-10H,11H2,1-2H3;1-3H3 |
| InChIKey | SPIAOFHQXQEBFX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |