C36H34O10 — CID 11050415
dimethyl (2R,3S)-2,3-bis(3-methoxy-4-phenylmethoxybenzoyl)butanedioate (PubChem CID 11050415) has the molecular formula C36H34O10 and a molecular weight of 626.66 g/mol. Its IUPAC name is dimethyl (2R,3S)-2,3-bis(3-methoxy-4-phenylmethoxybenzoyl)butanedioate.
| Compound Name | dimethyl (2R,3S)-2,3-bis(3-methoxy-4-phenylmethoxybenzoyl)butanedioate |
|---|---|
| PubChem CID | 11050415 |
| Molecular Formula | C36H34O10 |
| Molecular Weight | 626.66 g/mol |
| Exact Mass | 626.22 |
| IUPAC Name | dimethyl (2R,3S)-2,3-bis(3-methoxy-4-phenylmethoxybenzoyl)butanedioate |
| SMILES | COC(=O)[C@H](C(=O)c1ccc(OCc2ccccc2)c(OC)c1)[C@@H](C(=O)OC)C(=O)c1ccc(OCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C36H34O10/c1-41-29-19-25(15-17-27(29)45-21-23-11-7-5-8-12-23)33(37)31(35(39)43-3)32(36(40)44-4)34(38)26-16-18-28(30(20-26)42-2)46-22-24-13-9-6-10-14-24/h5-20,31-32H,21-22H2,1-4H3/t31-,32+ |
| InChIKey | DPNTTXPGTIEESV-MEKGRNQZSA-N |
| XLogP | 5.51 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.66 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|