methyl 3-methoxy-4-[2-(2-phenylmethoxyphenyl)ethenyl]benzoate

C24H22O4 — CID 70346485

IUPACmethyl 3-methoxy-4-[2-(2-phenylmethoxyphenyl)ethenyl]benzoate
SMILESCOC(=O)c1ccc(C=Cc2ccccc2OCc2ccccc2)c(OC)c1
InChIInChI=1S/C24H22O4/c1-26-23-16-21(24(25)27-2)15-14-20(23)13-12-19-10-6-7-11-22(19)28-17-18-8-4-3-5-9-18/h3-16H,17H2,1-2H3
InChIKeyCPSUAZFUFGFFNM-UHFFFAOYSA-N
MW374.44 g/mol
LogP5.23
Rot. Bonds7

About methyl 3-methoxy-4-[2-(2-phenylmethoxyphenyl)ethenyl]benzoate

methyl 3-methoxy-4-[2-(2-phenylmethoxyphenyl)ethenyl]benzoate (PubChem CID 70346485) has the molecular formula C24H22O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is methyl 3-methoxy-4-[2-(2-phenylmethoxyphenyl)ethenyl]benzoate.

Molecular Properties

Compound Namemethyl 3-methoxy-4-[2-(2-phenylmethoxyphenyl)ethenyl]benzoate
PubChem CID70346485
Molecular FormulaC24H22O4
Molecular Weight374.44 g/mol
Exact Mass374.15
IUPAC Namemethyl 3-methoxy-4-[2-(2-phenylmethoxyphenyl)ethenyl]benzoate
SMILESCOC(=O)c1ccc(C=Cc2ccccc2OCc2ccccc2)c(OC)c1
InChIInChI=1S/C24H22O4/c1-26-23-16-21(24(25)27-2)15-14-20(23)13-12-19-10-6-7-11-22(19)28-17-18-8-4-3-5-9-18/h3-16H,17H2,1-2H3
InChIKeyCPSUAZFUFGFFNM-UHFFFAOYSA-N
XLogP5.23
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms28
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500374.44
LogP ≤ 55.23
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'stilbene', 'substructure': 'N/A'}

Analyze methyl 3-methoxy-4-[2-(2-phenylmethoxyphenyl)ethenyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-methoxy-4-[2-(2-phenylmethoxyphenyl)ethenyl]benzoate?
The IUPAC name of methyl 3-methoxy-4-[2-(2-phenylmethoxyphenyl)ethenyl]benzoate (CID 70346485) is methyl 3-methoxy-4-[2-(2-phenylmethoxyphenyl)ethenyl]benzoate.
What is the SMILES notation for methyl 3-methoxy-4-[2-(2-phenylmethoxyphenyl)ethenyl]benzoate?
The canonical SMILES for methyl 3-methoxy-4-[2-(2-phenylmethoxyphenyl)ethenyl]benzoate is COC(=O)c1ccc(C=Cc2ccccc2OCc2ccccc2)c(OC)c1.
What is the InChIKey of methyl 3-methoxy-4-[2-(2-phenylmethoxyphenyl)ethenyl]benzoate?
The InChIKey is CPSUAZFUFGFFNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22O4/c1-26-23-16-21(24(25)27-2)15-14-20(23)13-12-19-10-6-7-11-22(19)28-17-18-8-4-3-5-9-18/h3-16H,17H2,1-2H3.
What are the key properties of methyl 3-methoxy-4-[2-(2-phenylmethoxyphenyl)ethenyl]benzoate?
methyl 3-methoxy-4-[2-(2-phenylmethoxyphenyl)ethenyl]benzoate has a molecular weight of 374.44 g/mol, XLogP of 5.23, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-methoxy-4-[2-(2-phenylmethoxyphenyl)ethenyl]benzoate is sourced from PubChem (CID 70346485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).