C33H30N2O5 — CID 4654190
methyl 4-[[2-[3-(benzylamino)-2-(benzylcarbamoyl)-3-oxoprop-1-enyl]phenoxy]methyl]benzoate (PubChem CID 4654190) has the molecular formula C33H30N2O5 and a molecular weight of 534.61 g/mol. Its IUPAC name is methyl 4-[[2-[3-(benzylamino)-2-(benzylcarbamoyl)-3-oxoprop-1-enyl]phenoxy]methyl]benzoate.
| Compound Name | methyl 4-[[2-[3-(benzylamino)-2-(benzylcarbamoyl)-3-oxoprop-1-enyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 4654190 |
| Molecular Formula | C33H30N2O5 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | methyl 4-[[2-[3-(benzylamino)-2-(benzylcarbamoyl)-3-oxoprop-1-enyl]phenoxy]methyl]benzoate |
| SMILES | COC(=O)c1ccc(COc2ccccc2C=C(C(=O)NCc2ccccc2)C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C33H30N2O5/c1-39-33(38)27-18-16-26(17-19-27)23-40-30-15-9-8-14-28(30)20-29(31(36)34-21-24-10-4-2-5-11-24)32(37)35-22-25-12-6-3-7-13-25/h2-20H,21-23H2,1H3,(H,34,36)(H,35,37) |
| InChIKey | QCCGTIBWKHUPIS-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|