C23H20O4 — CID 54000159
2-methoxy-4-[2-(2-phenylmethoxyphenyl)ethenyl]benzoic acid (PubChem CID 54000159) has the molecular formula C23H20O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-methoxy-4-[2-(2-phenylmethoxyphenyl)ethenyl]benzoic acid.
| Compound Name | 2-methoxy-4-[2-(2-phenylmethoxyphenyl)ethenyl]benzoic acid |
|---|---|
| PubChem CID | 54000159 |
| Molecular Formula | C23H20O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 2-methoxy-4-[2-(2-phenylmethoxyphenyl)ethenyl]benzoic acid |
| SMILES | COc1cc(C=Cc2ccccc2OCc2ccccc2)ccc1C(=O)O |
| InChI | InChI=1S/C23H20O4/c1-26-22-15-17(12-14-20(22)23(24)25)11-13-19-9-5-6-10-21(19)27-16-18-7-3-2-4-8-18/h2-15H,16H2,1H3,(H,24,25) |
| InChIKey | KKZKYWFBQPWENH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|