C23H20O4 — CID 15887380
(E)-1-(2-hydroxy-4-methoxyphenyl)-3-(2-phenylmethoxyphenyl)prop-2-en-1-one (PubChem CID 15887380) has the molecular formula C23H20O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is (E)-1-(2-hydroxy-4-methoxyphenyl)-3-(2-phenylmethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2-hydroxy-4-methoxyphenyl)-3-(2-phenylmethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 15887380 |
| Molecular Formula | C23H20O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (E)-1-(2-hydroxy-4-methoxyphenyl)-3-(2-phenylmethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2ccccc2OCc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C23H20O4/c1-26-19-12-13-20(22(25)15-19)21(24)14-11-18-9-5-6-10-23(18)27-16-17-7-3-2-4-8-17/h2-15,25H,16H2,1H3/b14-11+ |
| InChIKey | ZHCXAOZRMGROSE-SDNWHVSQSA-N |
| XLogP | 4.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|