C32H30O5 — CID 139826426
3-(4-ethoxy-2-phenylmethoxyphenyl)-1-(2-methoxy-4-phenylmethoxyphenyl)prop-2-en-1-one (PubChem CID 139826426) has the molecular formula C32H30O5 and a molecular weight of 494.59 g/mol. Its IUPAC name is 3-(4-ethoxy-2-phenylmethoxyphenyl)-1-(2-methoxy-4-phenylmethoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(4-ethoxy-2-phenylmethoxyphenyl)-1-(2-methoxy-4-phenylmethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 139826426 |
| Molecular Formula | C32H30O5 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 3-(4-ethoxy-2-phenylmethoxyphenyl)-1-(2-methoxy-4-phenylmethoxyphenyl)prop-2-en-1-one |
| SMILES | CCOc1ccc(C=CC(=O)c2ccc(OCc3ccccc3)cc2OC)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C32H30O5/c1-3-35-27-16-14-26(31(20-27)37-23-25-12-8-5-9-13-25)15-19-30(33)29-18-17-28(21-32(29)34-2)36-22-24-10-6-4-7-11-24/h4-21H,3,22-23H2,1-2H3 |
| InChIKey | QNPSPALDUHBGIM-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|