C30H26O5 — CID 139826440
3-(2-hydroxy-4-phenylmethoxyphenyl)-1-(2-methoxy-4-phenylmethoxyphenyl)prop-2-en-1-one (PubChem CID 139826440) has the molecular formula C30H26O5 and a molecular weight of 466.53 g/mol. Its IUPAC name is 3-(2-hydroxy-4-phenylmethoxyphenyl)-1-(2-methoxy-4-phenylmethoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(2-hydroxy-4-phenylmethoxyphenyl)-1-(2-methoxy-4-phenylmethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 139826440 |
| Molecular Formula | C30H26O5 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 3-(2-hydroxy-4-phenylmethoxyphenyl)-1-(2-methoxy-4-phenylmethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(OCc2ccccc2)ccc1C(=O)C=Cc1ccc(OCc2ccccc2)cc1O |
| InChI | InChI=1S/C30H26O5/c1-33-30-19-26(35-21-23-10-6-3-7-11-23)15-16-27(30)28(31)17-13-24-12-14-25(18-29(24)32)34-20-22-8-4-2-5-9-22/h2-19,32H,20-21H2,1H3 |
| InChIKey | JUGSMFUAPMBOMB-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|