C40H38O5 — CID 54134637
1-[2,4-bis(phenylmethoxy)phenyl]-3-(2-methoxy-3,4,6-trimethyl-5-phenylmethoxyphenyl)prop-2-en-1-one (PubChem CID 54134637) has the molecular formula C40H38O5 and a molecular weight of 598.74 g/mol. Its IUPAC name is 1-[2,4-bis(phenylmethoxy)phenyl]-3-(2-methoxy-3,4,6-trimethyl-5-phenylmethoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-[2,4-bis(phenylmethoxy)phenyl]-3-(2-methoxy-3,4,6-trimethyl-5-phenylmethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 54134637 |
| Molecular Formula | C40H38O5 |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.27 |
| IUPAC Name | 1-[2,4-bis(phenylmethoxy)phenyl]-3-(2-methoxy-3,4,6-trimethyl-5-phenylmethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1c(C)c(C)c(OCc2ccccc2)c(C)c1C=CC(=O)c1ccc(OCc2ccccc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C40H38O5/c1-28-29(2)40(42-4)35(30(3)39(28)45-27-33-18-12-7-13-19-33)22-23-37(41)36-21-20-34(43-25-31-14-8-5-9-15-31)24-38(36)44-26-32-16-10-6-11-17-32/h5-24H,25-27H2,1-4H3 |
| InChIKey | NWURBUKVHQNDET-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|