C23H21NO4 — CID 52643113
(E)-1-(2,4-dimethoxyphenyl)-3-[2-(pyridin-3-ylmethoxy)phenyl]prop-2-en-1-one (PubChem CID 52643113) has the molecular formula C23H21NO4 and a molecular weight of 375.42 g/mol. Its IUPAC name is (E)-1-(2,4-dimethoxyphenyl)-3-[2-(pyridin-3-ylmethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(2,4-dimethoxyphenyl)-3-[2-(pyridin-3-ylmethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 52643113 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | (E)-1-(2,4-dimethoxyphenyl)-3-[2-(pyridin-3-ylmethoxy)phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2ccccc2OCc2cccnc2)c(OC)c1 |
| InChI | InChI=1S/C23H21NO4/c1-26-19-10-11-20(23(14-19)27-2)21(25)12-9-18-7-3-4-8-22(18)28-16-17-6-5-13-24-15-17/h3-15H,16H2,1-2H3/b12-9+ |
| InChIKey | ATLMQBJZWBODFA-FMIVXFBMSA-N |
| XLogP | 4.57 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|