C25H24O5 — CID 139826653
1-(4-ethoxy-2-methoxyphenyl)-3-(2-hydroxy-4-phenylmethoxyphenyl)prop-2-en-1-one (PubChem CID 139826653) has the molecular formula C25H24O5 and a molecular weight of 404.46 g/mol. Its IUPAC name is 1-(4-ethoxy-2-methoxyphenyl)-3-(2-hydroxy-4-phenylmethoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(4-ethoxy-2-methoxyphenyl)-3-(2-hydroxy-4-phenylmethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 139826653 |
| Molecular Formula | C25H24O5 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 1-(4-ethoxy-2-methoxyphenyl)-3-(2-hydroxy-4-phenylmethoxyphenyl)prop-2-en-1-one |
| SMILES | CCOc1ccc(C(=O)C=Cc2ccc(OCc3ccccc3)cc2O)c(OC)c1 |
| InChI | InChI=1S/C25H24O5/c1-3-29-21-12-13-22(25(16-21)28-2)23(26)14-10-19-9-11-20(15-24(19)27)30-17-18-7-5-4-6-8-18/h4-16,27H,3,17H2,1-2H3 |
| InChIKey | UFRORQYRLWHNAN-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|