C33H32O5 — CID 139826532
3-[2,4-bis(phenylmethoxy)phenyl]-1-(2,4-diethoxyphenyl)prop-2-en-1-one (PubChem CID 139826532) has the molecular formula C33H32O5 and a molecular weight of 508.61 g/mol. Its IUPAC name is 3-[2,4-bis(phenylmethoxy)phenyl]-1-(2,4-diethoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-[2,4-bis(phenylmethoxy)phenyl]-1-(2,4-diethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 139826532 |
| Molecular Formula | C33H32O5 |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | 3-[2,4-bis(phenylmethoxy)phenyl]-1-(2,4-diethoxyphenyl)prop-2-en-1-one |
| SMILES | CCOc1ccc(C(=O)C=Cc2ccc(OCc3ccccc3)cc2OCc2ccccc2)c(OCC)c1 |
| InChI | InChI=1S/C33H32O5/c1-3-35-28-18-19-30(33(22-28)36-4-2)31(34)20-16-27-15-17-29(37-23-25-11-7-5-8-12-25)21-32(27)38-24-26-13-9-6-10-14-26/h5-22H,3-4,23-24H2,1-2H3 |
| InChIKey | ZSPOCUSSHCWKJU-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|