C33H34O5 — CID 139828116
1-[2,4-bis(phenylmethoxy)phenyl]-3-(2,4-diethoxyphenyl)prop-2-en-1-ol (PubChem CID 139828116) has the molecular formula C33H34O5 and a molecular weight of 510.63 g/mol. Its IUPAC name is 1-[2,4-bis(phenylmethoxy)phenyl]-3-(2,4-diethoxyphenyl)prop-2-en-1-ol.
| Compound Name | 1-[2,4-bis(phenylmethoxy)phenyl]-3-(2,4-diethoxyphenyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 139828116 |
| Molecular Formula | C33H34O5 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | 1-[2,4-bis(phenylmethoxy)phenyl]-3-(2,4-diethoxyphenyl)prop-2-en-1-ol |
| SMILES | CCOc1ccc(C=CC(O)c2ccc(OCc3ccccc3)cc2OCc2ccccc2)c(OCC)c1 |
| InChI | InChI=1S/C33H34O5/c1-3-35-28-17-15-27(32(21-28)36-4-2)16-20-31(34)30-19-18-29(37-23-25-11-7-5-8-12-25)22-33(30)38-24-26-13-9-6-10-14-26/h5-22,31,34H,3-4,23-24H2,1-2H3 |
| InChIKey | GMZDVEODIDJVOD-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |