C26H24O7 — CID 139828158
[4-[3-(2-acetyloxy-4-hydroxyphenyl)-1-hydroxyprop-2-enyl]-3-phenylmethoxyphenyl] acetate (PubChem CID 139828158) has the molecular formula C26H24O7 and a molecular weight of 448.47 g/mol. Its IUPAC name is [4-[3-(2-acetyloxy-4-hydroxyphenyl)-1-hydroxyprop-2-enyl]-3-phenylmethoxyphenyl] acetate.
| Compound Name | [4-[3-(2-acetyloxy-4-hydroxyphenyl)-1-hydroxyprop-2-enyl]-3-phenylmethoxyphenyl] acetate |
|---|---|
| PubChem CID | 139828158 |
| Molecular Formula | C26H24O7 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | [4-[3-(2-acetyloxy-4-hydroxyphenyl)-1-hydroxyprop-2-enyl]-3-phenylmethoxyphenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(O)C=Cc2ccc(O)cc2OC(C)=O)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C26H24O7/c1-17(27)32-22-11-12-23(26(15-22)31-16-19-6-4-3-5-7-19)24(30)13-9-20-8-10-21(29)14-25(20)33-18(2)28/h3-15,24,29-30H,16H2,1-2H3 |
| InChIKey | WLKZPISRTJSZIK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|