C22H26O6 — CID 139828284
[4-[3-(2,4-diethoxyphenyl)-1-hydroxyprop-2-enyl]-3-methoxyphenyl] acetate (PubChem CID 139828284) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is [4-[3-(2,4-diethoxyphenyl)-1-hydroxyprop-2-enyl]-3-methoxyphenyl] acetate.
| Compound Name | [4-[3-(2,4-diethoxyphenyl)-1-hydroxyprop-2-enyl]-3-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 139828284 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | [4-[3-(2,4-diethoxyphenyl)-1-hydroxyprop-2-enyl]-3-methoxyphenyl] acetate |
| SMILES | CCOc1ccc(C=CC(O)c2ccc(OC(C)=O)cc2OC)c(OCC)c1 |
| InChI | InChI=1S/C22H26O6/c1-5-26-17-9-7-16(21(13-17)27-6-2)8-12-20(24)19-11-10-18(28-15(3)23)14-22(19)25-4/h7-14,20,24H,5-6H2,1-4H3 |
| InChIKey | NWKZBHPGROADGS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|