C32H32O5 — CID 139828459
1-(4-ethoxy-2-phenylmethoxyphenyl)-3-(2-methoxy-4-phenylmethoxyphenyl)prop-2-en-1-ol (PubChem CID 139828459) has the molecular formula C32H32O5 and a molecular weight of 496.60 g/mol. Its IUPAC name is 1-(4-ethoxy-2-phenylmethoxyphenyl)-3-(2-methoxy-4-phenylmethoxyphenyl)prop-2-en-1-ol.
| Compound Name | 1-(4-ethoxy-2-phenylmethoxyphenyl)-3-(2-methoxy-4-phenylmethoxyphenyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 139828459 |
| Molecular Formula | C32H32O5 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | 1-(4-ethoxy-2-phenylmethoxyphenyl)-3-(2-methoxy-4-phenylmethoxyphenyl)prop-2-en-1-ol |
| SMILES | CCOc1ccc(C(O)C=Cc2ccc(OCc3ccccc3)cc2OC)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C32H32O5/c1-3-35-27-17-18-29(32(21-27)37-23-25-12-8-5-9-13-25)30(33)19-15-26-14-16-28(20-31(26)34-2)36-22-24-10-6-4-7-11-24/h4-21,30,33H,3,22-23H2,1-2H3 |
| InChIKey | WNHIWNIGUSXKPU-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |