C24H22O5 — CID 139826677
1-(2,4-dimethoxyphenyl)-3-(2-hydroxy-4-phenylmethoxyphenyl)prop-2-en-1-one (PubChem CID 139826677) has the molecular formula C24H22O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-(2-hydroxy-4-phenylmethoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-(2-hydroxy-4-phenylmethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 139826677 |
| Molecular Formula | C24H22O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-(2-hydroxy-4-phenylmethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)C=Cc2ccc(OCc3ccccc3)cc2O)c(OC)c1 |
| InChI | InChI=1S/C24H22O5/c1-27-19-11-12-21(24(15-19)28-2)22(25)13-9-18-8-10-20(14-23(18)26)29-16-17-6-4-3-5-7-17/h3-15,26H,16H2,1-2H3 |
| InChIKey | DVXWMEVOTKZYNH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|