C20H17N3O4 — CID 75535890
3-methyl-5-[(E)-3-[2-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]-1H-pyrimidine-2,4-dione (PubChem CID 75535890) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is 3-methyl-5-[(E)-3-[2-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 3-methyl-5-[(E)-3-[2-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 75535890 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 3-methyl-5-[(E)-3-[2-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]-1H-pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)[nH]cc(C(=O)/C=C/c2ccccc2OCc2cccnc2)c1=O |
| InChI | InChI=1S/C20H17N3O4/c1-23-19(25)16(12-22-20(23)26)17(24)9-8-15-6-2-3-7-18(15)27-13-14-5-4-10-21-11-14/h2-12H,13H2,1H3,(H,22,26)/b9-8+ |
| InChIKey | QXVODBIESVMEJQ-CMDGGOBGSA-N |
| XLogP | 1.94 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|