C23H18O5 — CID 10714433
4-hydroxy-3-[(E)-3-(2-phenylmethoxyphenyl)prop-2-enoyl]benzoic acid (PubChem CID 10714433) has the molecular formula C23H18O5 and a molecular weight of 374.39 g/mol. Its IUPAC name is 4-hydroxy-3-[(E)-3-(2-phenylmethoxyphenyl)prop-2-enoyl]benzoic acid.
| Compound Name | 4-hydroxy-3-[(E)-3-(2-phenylmethoxyphenyl)prop-2-enoyl]benzoic acid |
|---|---|
| PubChem CID | 10714433 |
| Molecular Formula | C23H18O5 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 4-hydroxy-3-[(E)-3-(2-phenylmethoxyphenyl)prop-2-enoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(O)c(C(=O)/C=C/c2ccccc2OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H18O5/c24-20(19-14-18(23(26)27)11-13-21(19)25)12-10-17-8-4-5-9-22(17)28-15-16-6-2-1-3-7-16/h1-14,25H,15H2,(H,26,27)/b12-10+ |
| InChIKey | MFAYZDRDBRIRME-ZRDIBKRKSA-N |
| XLogP | 4.57 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|