C29H30O4 — CID 158805588
(E)-1-[2-hydroxy-4-methyl-3-(3-methylbut-2-enyl)phenyl]-3-(4-methoxy-2-phenylmethoxyphenyl)prop-2-en-1-one (PubChem CID 158805588) has the molecular formula C29H30O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is (E)-1-[2-hydroxy-4-methyl-3-(3-methylbut-2-enyl)phenyl]-3-(4-methoxy-2-phenylmethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[2-hydroxy-4-methyl-3-(3-methylbut-2-enyl)phenyl]-3-(4-methoxy-2-phenylmethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 158805588 |
| Molecular Formula | C29H30O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | (E)-1-[2-hydroxy-4-methyl-3-(3-methylbut-2-enyl)phenyl]-3-(4-methoxy-2-phenylmethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(C)c(CC=C(C)C)c2O)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C29H30O4/c1-20(2)10-15-25-21(3)11-16-26(29(25)31)27(30)17-13-23-12-14-24(32-4)18-28(23)33-19-22-8-6-5-7-9-22/h5-14,16-18,31H,15,19H2,1-4H3/b17-13+ |
| InChIKey | WBOJLZVXTHCBTI-GHRIWEEISA-N |
| XLogP | 6.69 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|