C26H24O4 — CID 7973176
methyl 4-[[2-[(E)-3-(2,4-dimethylphenyl)-3-oxoprop-1-enyl]phenoxy]methyl]benzoate (PubChem CID 7973176) has the molecular formula C26H24O4 and a molecular weight of 400.47 g/mol. Its IUPAC name is methyl 4-[[2-[(E)-3-(2,4-dimethylphenyl)-3-oxoprop-1-enyl]phenoxy]methyl]benzoate.
| Compound Name | methyl 4-[[2-[(E)-3-(2,4-dimethylphenyl)-3-oxoprop-1-enyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 7973176 |
| Molecular Formula | C26H24O4 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | methyl 4-[[2-[(E)-3-(2,4-dimethylphenyl)-3-oxoprop-1-enyl]phenoxy]methyl]benzoate |
| SMILES | COC(=O)c1ccc(COc2ccccc2/C=C/C(=O)c2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C26H24O4/c1-18-8-14-23(19(2)16-18)24(27)15-13-21-6-4-5-7-25(21)30-17-20-9-11-22(12-10-20)26(28)29-3/h4-16H,17H2,1-3H3/b15-13+ |
| InChIKey | ZAGPMHJYWUBVIB-FYWRMAATSA-N |
| XLogP | 5.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|