C23H18Br2O3 — CID 18973794
methyl 3,5-dibromo-4-[(E)-2-(2-phenylmethoxyphenyl)ethenyl]benzoate (PubChem CID 18973794) has the molecular formula C23H18Br2O3 and a molecular weight of 502.20 g/mol. Its IUPAC name is methyl 3,5-dibromo-4-[(E)-2-(2-phenylmethoxyphenyl)ethenyl]benzoate.
| Compound Name | methyl 3,5-dibromo-4-[(E)-2-(2-phenylmethoxyphenyl)ethenyl]benzoate |
|---|---|
| PubChem CID | 18973794 |
| Molecular Formula | C23H18Br2O3 |
| Molecular Weight | 502.20 g/mol |
| Exact Mass | 499.96 |
| IUPAC Name | methyl 3,5-dibromo-4-[(E)-2-(2-phenylmethoxyphenyl)ethenyl]benzoate |
| SMILES | COC(=O)c1cc(Br)c(/C=C/c2ccccc2OCc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C23H18Br2O3/c1-27-23(26)18-13-20(24)19(21(25)14-18)12-11-17-9-5-6-10-22(17)28-15-16-7-3-2-4-8-16/h2-14H,15H2,1H3/b12-11+ |
| InChIKey | XMWQAPXRBAHCEN-VAWYXSNFSA-N |
| XLogP | 6.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.20 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|