C21H23BrO9 — CID 68978666
(3,4,5,6-tetrahydroxyoxan-2-yl)methyl 4-[2-(3,4-dihydroxyphenyl)ethenyl]benzoate;hydrobromide (PubChem CID 68978666) has the molecular formula C21H23BrO9 and a molecular weight of 499.31 g/mol. Its IUPAC name is (3,4,5,6-tetrahydroxyoxan-2-yl)methyl 4-[2-(3,4-dihydroxyphenyl)ethenyl]benzoate;hydrobromide.
| Compound Name | (3,4,5,6-tetrahydroxyoxan-2-yl)methyl 4-[2-(3,4-dihydroxyphenyl)ethenyl]benzoate;hydrobromide |
|---|---|
| PubChem CID | 68978666 |
| Molecular Formula | C21H23BrO9 |
| Molecular Weight | 499.31 g/mol |
| Exact Mass | 498.05 |
| IUPAC Name | (3,4,5,6-tetrahydroxyoxan-2-yl)methyl 4-[2-(3,4-dihydroxyphenyl)ethenyl]benzoate;hydrobromide |
| SMILES | Br.O=C(OCC1OC(O)C(O)C(O)C1O)c1ccc(C=Cc2ccc(O)c(O)c2)cc1 |
| InChI | InChI=1S/C21H22O9.BrH/c22-14-8-5-12(9-15(14)23)2-1-11-3-6-13(7-4-11)20(27)29-10-16-17(24)18(25)19(26)21(28)30-16;/h1-9,16-19,21-26,28H,10H2;1H |
| InChIKey | JFFDFCLVPRNLFO-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.31 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|