C27H26O10 — CID 163185179
[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[3-hydroxy-5-[(E)-2-(4-hydroxyphenyl)ethenyl]phenoxy]oxan-2-yl]methyl 4-hydroxybenzoate (PubChem CID 163185179) has the molecular formula C27H26O10 and a molecular weight of 510.50 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[3-hydroxy-5-[(E)-2-(4-hydroxyphenyl)ethenyl]phenoxy]oxan-2-yl]methyl 4-hydroxybenzoate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[3-hydroxy-5-[(E)-2-(4-hydroxyphenyl)ethenyl]phenoxy]oxan-2-yl]methyl 4-hydroxybenzoate |
|---|---|
| PubChem CID | 163185179 |
| Molecular Formula | C27H26O10 |
| Molecular Weight | 510.50 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[3-hydroxy-5-[(E)-2-(4-hydroxyphenyl)ethenyl]phenoxy]oxan-2-yl]methyl 4-hydroxybenzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](Oc2cc(O)cc(/C=C/c3ccc(O)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O)c1ccc(O)cc1 |
| InChI | InChI=1S/C27H26O10/c28-18-7-3-15(4-8-18)1-2-16-11-20(30)13-21(12-16)36-27-25(33)24(32)23(31)22(37-27)14-35-26(34)17-5-9-19(29)10-6-17/h1-13,22-25,27-33H,14H2/b2-1+/t22-,23-,24+,25-,27-/m1/s1 |
| InChIKey | ASJOHWVDWODOPX-ODXJXHFHSA-N |
| XLogP | 2.02 |
| TPSA | 166.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.50 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|