C28H36O9 — CID 75293889
[3,4,5-trihydroxy-6-[3-hydroxy-5-[2-(4-hydroxyphenyl)ethenyl]phenoxy]oxan-2-yl]methyl octanoate (PubChem CID 75293889) has the molecular formula C28H36O9 and a molecular weight of 516.59 g/mol. Its IUPAC name is [3,4,5-trihydroxy-6-[3-hydroxy-5-[2-(4-hydroxyphenyl)ethenyl]phenoxy]oxan-2-yl]methyl octanoate.
| Compound Name | [3,4,5-trihydroxy-6-[3-hydroxy-5-[2-(4-hydroxyphenyl)ethenyl]phenoxy]oxan-2-yl]methyl octanoate |
|---|---|
| PubChem CID | 75293889 |
| Molecular Formula | C28H36O9 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | [3,4,5-trihydroxy-6-[3-hydroxy-5-[2-(4-hydroxyphenyl)ethenyl]phenoxy]oxan-2-yl]methyl octanoate |
| SMILES | CCCCCCCC(=O)OCC1OC(Oc2cc(O)cc(C=Cc3ccc(O)cc3)c2)C(O)C(O)C1O |
| InChI | InChI=1S/C28H36O9/c1-2-3-4-5-6-7-24(31)35-17-23-25(32)26(33)27(34)28(37-23)36-22-15-19(14-21(30)16-22)9-8-18-10-12-20(29)13-11-18/h8-16,23,25-30,32-34H,2-7,17H2,1H3 |
| InChIKey | JXYZHWPPADODGH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|