C17H32O7 — CID 10860995
[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl decanoate (PubChem CID 10860995) has the molecular formula C17H32O7 and a molecular weight of 348.44 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl decanoate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl decanoate |
|---|---|
| PubChem CID | 10860995 |
| Molecular Formula | C17H32O7 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl decanoate |
| SMILES | CCCCCCCCCC(=O)OC[C@H]1O[C@H](OC)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H32O7/c1-3-4-5-6-7-8-9-10-13(18)23-11-12-14(19)15(20)16(21)17(22-2)24-12/h12,14-17,19-21H,3-11H2,1-2H3/t12-,14-,15+,16-,17+/m1/s1 |
| InChIKey | SWKUJNURBCUIKQ-CMZRPVNOSA-N |
| XLogP | 1.12 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|