C18H32O7 — CID 11726043
[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl undec-10-enoate (PubChem CID 11726043) has the molecular formula C18H32O7 and a molecular weight of 360.45 g/mol. Its IUPAC name is [(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl undec-10-enoate.
| Compound Name | [(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl undec-10-enoate |
|---|---|
| PubChem CID | 11726043 |
| Molecular Formula | C18H32O7 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | [(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)OC[C@H]1O[C@H](OC)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H32O7/c1-3-4-5-6-7-8-9-10-11-14(19)24-12-13-15(20)16(21)17(22)18(23-2)25-13/h3,13,15-18,20-22H,1,4-12H2,2H3/t13-,15-,16+,17+,18+/m1/s1 |
| InChIKey | NFGYZIQVOIYGNK-MWIANEHASA-N |
| XLogP | 1.29 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|