C15H24O9 — CID 102185269
6-O-ethenyl 1-O-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl] hexanedioate (PubChem CID 102185269) has the molecular formula C15H24O9 and a molecular weight of 348.35 g/mol. Its IUPAC name is 6-O-ethenyl 1-O-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl] hexanedioate.
| Compound Name | 6-O-ethenyl 1-O-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl] hexanedioate |
|---|---|
| PubChem CID | 102185269 |
| Molecular Formula | C15H24O9 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 6-O-ethenyl 1-O-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl] hexanedioate |
| SMILES | C=COC(=O)CCCCC(=O)OC[C@H]1O[C@H](OC)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H24O9/c1-3-22-10(16)6-4-5-7-11(17)23-8-9-12(18)13(19)14(20)15(21-2)24-9/h3,9,12-15,18-20H,1,4-8H2,2H3/t9-,12-,13+,14-,15+/m1/s1 |
| InChIKey | FYYQNHCIXFHTIF-CEVLRCNZSA-N |
| XLogP | -0.77 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|