C12H18O9 — CID 102410329
4-O-ethenyl 1-O-[[(2R,3R,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl] butanedioate (PubChem CID 102410329) has the molecular formula C12H18O9 and a molecular weight of 306.27 g/mol. Its IUPAC name is 4-O-ethenyl 1-O-[[(2R,3R,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl] butanedioate.
| Compound Name | 4-O-ethenyl 1-O-[[(2R,3R,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl] butanedioate |
|---|---|
| PubChem CID | 102410329 |
| Molecular Formula | C12H18O9 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-O-ethenyl 1-O-[[(2R,3R,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl] butanedioate |
| SMILES | C=COC(=O)CCC(=O)OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H18O9/c1-2-19-7(13)3-4-8(14)20-5-6-9(15)10(16)11(17)12(18)21-6/h2,6,9-12,15-18H,1,3-5H2/t6-,9+,10+,11-,12-/m1/s1 |
| InChIKey | WYVVQXGIBULELB-LTVFLDSHSA-N |
| XLogP | -2.20 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|