C11H22O7 — CID 161366700
methane;(3,4,5,6-tetrahydroxyoxan-2-yl)methyl prop-2-enoate (PubChem CID 161366700) has the molecular formula C11H22O7 and a molecular weight of 266.29 g/mol. Its IUPAC name is methane;(3,4,5,6-tetrahydroxyoxan-2-yl)methyl prop-2-enoate.
| Compound Name | methane;(3,4,5,6-tetrahydroxyoxan-2-yl)methyl prop-2-enoate |
|---|---|
| PubChem CID | 161366700 |
| Molecular Formula | C11H22O7 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | methane;(3,4,5,6-tetrahydroxyoxan-2-yl)methyl prop-2-enoate |
| SMILES | C.C.C=CC(=O)OCC1OC(O)C(O)C(O)C1O |
| InChI | InChI=1S/C9H14O7.2CH4/c1-2-5(10)15-3-4-6(11)7(12)8(13)9(14)16-4;;/h2,4,6-9,11-14H,1,3H2;2*1H4 |
| InChIKey | VPXHYGUWRHIRIX-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|