C8H14O8 — CID 10331746
methyl [(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl carbonate (PubChem CID 10331746) has the molecular formula C8H14O8 and a molecular weight of 238.19 g/mol. Its IUPAC name is methyl [(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl carbonate.
| Compound Name | methyl [(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 10331746 |
| Molecular Formula | C8H14O8 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | methyl [(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl carbonate |
| SMILES | COC(=O)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H14O8/c1-14-8(13)15-2-3-4(9)5(10)6(11)7(12)16-3/h3-7,9-12H,2H2,1H3/t3-,4-,5+,6-,7?/m1/s1 |
| InChIKey | BRAWUUMTEGQGCB-WLDMJGECSA-N |
| XLogP | -2.43 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |